CAS 82925-01-7
:6,7-dimethoxy-2-[2-(4-nitrophenyl)ethyl]-1,2,3,4-tetrahydroisoquinoline
Description:
6,7-Dimethoxy-2-[2-(4-nitrophenyl)ethyl]-1,2,3,4-tetrahydroisoquinoline is a complex organic compound characterized by its tetrahydroisoquinoline core structure, which is a bicyclic framework commonly found in various natural products and pharmaceuticals. The presence of two methoxy groups at the 6 and 7 positions enhances its lipophilicity and may influence its biological activity. The compound also features a 4-nitrophenyl group attached via a 2-ethyl linker, which can contribute to its electronic properties and potential interactions with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential for interactions with neurotransmitter systems, possibly indicating psychoactive properties. Additionally, the nitro group can serve as a site for further chemical modifications, potentially leading to derivatives with enhanced efficacy or selectivity. Overall, the unique combination of functional groups and structural features positions this compound as a candidate for further investigation in drug development and research applications.
Formula:C19H22N2O4
InChI:InChI=1/C19H22N2O4/c1-24-18-11-15-8-10-20(13-16(15)12-19(18)25-2)9-7-14-3-5-17(6-4-14)21(22)23/h3-6,11-12H,7-10,13H2,1-2H3
SMILES:COc1cc2CCN(CCc3ccc(cc3)N(=O)=O)Cc2cc1OC
Synonyms:- 1,2,3,4-Tetrahydro-6,7-dimethoxy-2-[2-(4-nitrophenyl)ethyl]isoquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6,7-Dimethoxy-2-(4-nitrophenethyl)-1,2,3,4-tetrahydroisoquinoline
CAS:Formula:C19H22N2O4Color and Shape:SolidMolecular weight:342.3890
