CAS 82928-10-7

2-(1,3-benzothiazol-2-yl)ethanamine

Description:

2-(1,3-benzothiazol-2-yl)ethanamine, with the CAS number 82928-10-7, is an organic compound characterized by its benzothiazole moiety, which contributes to its aromatic properties and potential biological activity. This compound features an ethanamine group, indicating the presence of an amine functional group attached to a two-carbon ethyl chain. The benzothiazole structure is known for its role in various chemical and pharmaceutical applications, often exhibiting properties such as fluorescence and biological activity, including antimicrobial and anticancer effects. The compound is typically a solid at room temperature and may be soluble in polar organic solvents. Its reactivity can be influenced by the amine group, allowing for potential interactions in various chemical reactions, including nucleophilic substitutions. Due to its unique structure, 2-(1,3-benzothiazol-2-yl)ethanamine may serve as a valuable intermediate in the synthesis of more complex molecules in medicinal chemistry and materials science. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₉H₁₀N₂S

InChI: InChI=1/C9H10N2S/c10-6-5-9-11-7-3-1-2-4-8(7)12-9/h1-4H,5-6,10H2

SMILES: c1ccc2c(c1)nc(CCN)s2

Synonyms:

• 2-Benzothiazoleethanamine

2-(Benzo[d]thiazol-2-yl)ethanamine

CAS: 82928-10-7

Formula: C₉H₁₀N₂S

Molecular weight: 178.2541

Ref: IN-DA005EOX

2-(1,3-benzothiazol-2-yl)ethanamine

CAS: 82928-10-7

2-(1,3-benzothiazol-2-yl)ethanamine

Purity: ≥95%

Molecular weight: 178.25g/mol

Ref: 54-OR480538