CAS 82933-91-3
:D-Glucopyranoside, methyl, 2,6-di-(9Z)-9-octadecenoate
Description:
D-Glucopyranoside, methyl, 2,6-di-(9Z)-9-octadecenoate, with the CAS number 82933-91-3, is a glycoside that features a methylated form of D-glucose linked to two octadecenoate fatty acid chains. This compound is characterized by its hydrophilic glucose moiety, which enhances its solubility in polar solvents, while the long hydrophobic fatty acid chains contribute to its amphiphilic nature. The presence of the double bonds in the octadecenoate chains indicates that it has unsaturated fatty acid characteristics, which can influence its physical properties, such as melting point and reactivity. This compound may exhibit surfactant properties, making it useful in various applications, including food, cosmetics, and pharmaceuticals. Additionally, its structure suggests potential biological activity, as glycosides often play roles in cellular signaling and metabolism. Overall, D-Glucopyranoside, methyl, 2,6-di-(9Z)-9-octadecenoate is a complex molecule with unique properties stemming from its dual hydrophilic and hydrophobic characteristics.
Formula:C43H78O8
InChI:InChI=1S/C43H78O8/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38(44)49-36-37-40(46)41(47)42(43(48-3)50-37)51-39(45)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,37,40-43,46-47H,4-17,22-36H2,1-3H3/b20-18-,21-19-/t37-,40-,41+,42-,43?/m1/s1
InChI key:InChIKey=GCHVTEWZZDWDIA-JNWMSGOHSA-N
SMILES:O(C(CCCCCCC/C=C\CCCCCCCC)=O)[C@H]1C(OC)O[C@H](COC(CCCCCCC/C=C\CCCCCCCC)=O)[C@@H](O)[C@@H]1O
Synonyms:- <span class="text-smallcaps">D</span>-Glucopyranoside, methyl, 2,6-di-(9Z)-9-octadecenoate
- <span class="text-smallcaps">D</span>-Glucopyranoside, methyl, 2,6-di-9-octadecenoate, (Z,Z)-
- D-Glucopyranoside, methyl, 2,6-di-(9Z)-9-octadecenoate
- D-Glucopyranoside, methyl, 2,6-di-9-octadecenoate, (Z,Z)-
- methyl 2,6-di-O--(9E)-octadec-9-enoyl-D-glucopyranoside
- D-Glucopyranoside methyl 2,6-dioleate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Methyl glucoside dioleate
CAS:<p>Methyl glucoside dioleate is a fatty acid ester that is a cross-linking agent. It can be used as a neutralizer and surfactant in cosmetic products. Methyl glucoside dioleate has been shown to have synergistic effects with hyaluronic acid, which stimulates the production of collagen and elastin. It also has skin-softening properties due to its ability to form films on the skin surface and reduce water loss by forming a hydrophobic barrier. Methyl glucoside dioleate is not known to cause allergic reactions or other adverse effects when applied to humans, although there are no long-term studies on this topic.</p>Purity:Min. 95%
