CAS 82940-37-2
:1,2-diphenyl-2-(phenylamino)ethanol
Description:
1,2-Diphenyl-2-(phenylamino)ethanol, with the CAS number 82940-37-2, is an organic compound characterized by its complex structure featuring two phenyl groups and an amino group attached to a central carbon atom that also bears a hydroxyl group. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and organic synthesis. The presence of both hydroxyl and amino functional groups contributes to its ability to engage in hydrogen bonding, which can influence its solubility and reactivity. Additionally, the compound may exhibit chiral properties due to the presence of a stereocenter, leading to the possibility of enantiomeric forms. Its chemical behavior can be influenced by the electron-donating and electron-withdrawing effects of the phenyl groups, making it a subject of interest in studies related to molecular interactions and reactivity patterns. Overall, 1,2-diphenyl-2-(phenylamino)ethanol is a versatile compound with significant implications in various chemical research fields.
Formula:C20H19NO
InChI:InChI=1/C20H19NO/c22-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)21-18-14-8-3-9-15-18/h1-15,19-22H
SMILES:c1ccc(cc1)C(C(c1ccccc1)O)Nc1ccccc1
Synonyms:- 2-Anilino-1,2-diphenylethanol
- Benzeneethanol, Alpha-Phenyl-Beta-(Phenylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.