CymitQuimica logo

CAS 82947-63-5

:

3,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane-2,2-dicarbonitrile

Description:
3,3-Bis(trifluoromethyl)bicyclo[2.2.1]heptane-2,2-dicarbonitrile, with the CAS number 82947-63-5, is a bicyclic organic compound characterized by its unique structure that includes two trifluoromethyl groups and two cyano groups. The presence of trifluoromethyl groups imparts significant electronegativity and lipophilicity, enhancing the compound's stability and reactivity. The bicyclo[2.2.1]heptane framework contributes to its rigidity and steric hindrance, which can influence its chemical behavior and interactions. The dicarbonitrile functionality indicates the presence of two cyano groups, which are known for their strong electron-withdrawing properties, making the compound potentially useful in various chemical applications, including as a building block in organic synthesis or in materials science. Additionally, the compound's fluorinated nature may impart unique properties such as increased thermal stability and altered solubility in organic solvents. Overall, this compound's distinctive structural features and functional groups make it a subject of interest in both synthetic and applied chemistry.
Formula:C11H8F6N2
InChI:InChI=1/C11H8F6N2/c12-10(13,14)9(11(15,16)17)7-2-1-6(3-7)8(9,4-18)5-19/h6-7H,1-3H2
SMILES:C1CC2CC1C(C#N)(C#N)C2(C(F)(F)F)C(F)(F)F
Synonyms:
  • Bicyclo(2.2.1)heptane-2,2-dicarbonitrile, 3,3-bis(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.