CymitQuimica logo

CAS 82951-55-1

:

L-Lysine, N2-[S-(carboxymethyl)-L-cysteinyl]-

Description:
L-Lysine, N2-[S-(carboxymethyl)-L-cysteinyl]- (CAS 82951-55-1) is a modified amino acid that combines the properties of lysine and cysteine. This compound features a lysine backbone, which is characterized by its basic nature due to the presence of an amino group, making it essential for protein synthesis and various metabolic processes. The addition of a carboxymethyl group from cysteine introduces a thiol (-SH) functionality, which can participate in redox reactions and contribute to the formation of disulfide bonds in proteins. This modification enhances the compound's solubility in water and may influence its reactivity and biological activity. L-Lysine is known for its role in promoting growth and tissue repair, while the cysteine derivative may provide antioxidant properties. Overall, this compound is of interest in biochemical research and potential therapeutic applications, particularly in areas related to nutrition, cellular signaling, and protein engineering.
Formula:C11H21N3O5S
InChI:InChI=1S/C11H21N3O5S/c12-4-2-1-3-8(11(18)19)14-10(17)7(13)5-20-6-9(15)16/h7-8H,1-6,12-13H2,(H,14,17)(H,15,16)(H,18,19)/t7-,8-/m0/s1
InChI key:InChIKey=ZXFWVUHYOBPQHY-YUMQZZPRSA-N
SMILES:[C@H](NC([C@H](CSCC(O)=O)N)=O)(CCCCN)C(O)=O
Synonyms:
  • L-Lysine, N2-[S-(carboxymethyl)-L-cysteinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.