CymitQuimica logo

CAS 82953-57-9

:

Orange fluorescence dye F-240

Description:
Orange fluorescence dye F-240, identified by its CAS number 82953-57-9, is a synthetic organic compound known for its vibrant orange fluorescence properties. This dye is typically used in various applications, including biological staining, fluorescence microscopy, and as a tracer in various chemical processes. It exhibits strong absorption and emission characteristics, making it suitable for use in fluorescent labeling and imaging techniques. The compound is generally soluble in organic solvents, which enhances its utility in diverse formulations. Its stability under light and heat conditions is an important characteristic, allowing it to maintain its fluorescent properties over time. Additionally, safety data sheets indicate that, like many synthetic dyes, it should be handled with care, as it may pose health risks if ingested or if it comes into contact with skin. Overall, Orange fluorescence dye F-240 is valued in scientific research and industrial applications for its distinctive optical properties and versatility.
Formula:C48H42N2O4
InChI:InChI=1S/C48H42N2O4/c1-23(2)27-11-9-12-28(24(3)4)43(27)49-45(51)35-19-15-31-33-17-21-37-42-38(22-18-34(40(33)42)32-16-20-36(46(49)52)41(35)39(31)32)48(54)50(47(37)53)44-29(25(5)6)13-10-14-30(44)26(7)8/h9-26H,1-8H3
InChI key:NAZODJSYHDYJGP-UHFFFAOYSA-N
SMILES:CC(C)C1=C(C(=CC=C1)C(C)C)N2C(=O)C3=C4C(=CC=C5C4=C(C=C3)C6=C7C5=CC=C8C7=C(C=C6)C(=O)N(C8=O)C9=C(C=CC=C9C(C)C)C(C)C)C2=O
Synonyms:
  • N,N'-Bis(2,6-diisopropylphenyl)-3,4,9,10-perylenetetracarboxylic DiiMide
Found 5 products.