CAS 82955-02-0

α,α-Diethyl-4-(methylthio)benzenemethanol

Description:

α,α-Diethyl-4-(methylthio)benzenemethanol is an organic compound characterized by its complex structure, which includes a benzene ring substituted with both diethyl and methylthio groups, as well as a hydroxymethyl group. This compound typically exhibits properties associated with aromatic alcohols, such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydroxyl (-OH) group. The methylthio group can influence the compound's electronic properties and reactivity, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions. Its diethyl substituents contribute to steric hindrance, which may affect its interaction with other molecules. The compound's molecular structure suggests it may have applications in organic synthesis or as an intermediate in the production of more complex chemical entities. Safety data and handling precautions should be considered, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully understand its behavior in different chemical environments.

Formula: C₁₂H₁₈OS

InChI: InChI=1S/C12H18OS/c1-4-12(13,5-2)10-6-8-11(14-3)9-7-10/h6-9,13H,4-5H2,1-3H3

InChI key: InChIKey=PBKKRFYORSZQJP-UHFFFAOYSA-N

SMILES: C(CC)(CC)(O)C1=CC=C(SC)C=C1

Synonyms:

• Benzenemethanol, α,α-diethyl-4-(methylthio)-
• α,α-Diethyl-4-(methylthio)benzenemethanol