CAS 82957-06-0
:6-amidino-2-naphthol methanesulfonate
Description:
6-Amidino-2-naphthol methanesulfonate is a chemical compound characterized by its unique structure, which includes a naphthol moiety substituted with an amidino group and a methanesulfonate group. This compound typically appears as a solid and is soluble in water due to the presence of the methanesulfonate group, which enhances its ionic character. It is often utilized in biochemical and pharmaceutical research, particularly as a reagent or intermediate in the synthesis of various bioactive molecules. The amidino group contributes to its potential as a protease inhibitor, making it of interest in studies related to enzyme activity and inhibition. Additionally, the naphthol structure may impart specific optical properties, allowing for applications in fluorescence or colorimetric assays. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken during use. Overall, 6-amidino-2-naphthol methanesulfonate is a versatile compound with significant relevance in chemical and biological research.
Formula:C12H14N2O4S
InChI:InChI=1/C11H10N2O.CH4O3S/c12-11(13)9-2-1-8-6-10(14)4-3-7(8)5-9;1-5(2,3)4/h1-6,14H,(H3,12,13);1H3,(H,2,3,4)
SMILES:c1cc(cc2ccc(cc12)O)C(=N)N.CS(=O)(=O)O
Synonyms:- 6-Amidino-2-naphtol methanesulfonate
- 6-Hydroxynaphthalene-2-Carboximidamide Methanesulfonate (1:1)
- 6-Amidino-2-naphtholmethanesulfonate
- Amidinonaphtolmethanesulfonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Amidino-2-naphthol Methanesulfonate
CAS:Formula:C11H10N2O·CH4O3SPurity:>99.0%(T)(HPLC)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:282.316-Hydroxy-2-naphthimidamide methanesulfonate salt
CAS:Formula:C12H14N2O4SPurity:95%Color and Shape:SolidMolecular weight:282.31566-Hydroxy-2-naphthimidamide methanesulfonate
CAS:6-Hydroxy-2-naphthimidamide methanesulfonatePurity:98%Molecular weight:282.32g/mol6-Amidino-2-naphthol Methanesulfonate
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications 6-Amidino-2-naphthol Methanesulfonate is a useful N-terminal derivatization reagent for improving peptide fragmentation.<br>References Miyashita, M., et al.: Rapid Commun. Mass Spectrom., 25, 1130 (2011)<br></p>Formula:C11H10N2O·CH4SO3Color and Shape:NeatMolecular weight:186.21 + (96.10)




