CAS 82958-11-0
:3-oxo-1,3-dihydro-2-benzofuran-1-yl (3alpha,16alpha)-eburnamenine-14-carboxylate
Description:
3-Oxo-1,3-dihydro-2-benzofuran-1-yl (3alpha,16alpha)-eburnamenine-14-carboxylate, with the CAS number 82958-11-0, is a complex organic compound that belongs to the class of alkaloids. This substance is characterized by its unique structural features, including a benzofuran moiety and an alkaloid backbone derived from the Eburnamine family. The presence of a keto group and a carboxylate functional group contributes to its reactivity and potential biological activity. Alkaloids often exhibit a range of pharmacological properties, and compounds like this one may be investigated for their potential therapeutic effects. The compound's stereochemistry, particularly at the 3α and 16α positions, plays a crucial role in determining its biological interactions and efficacy. Additionally, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound represents a fascinating area of study within medicinal chemistry and natural product research.
Formula:C28H26N2O4
InChI:InChI=1/C28H26N2O4/c1-2-28-13-7-14-29-15-12-18-17-8-5-6-11-21(17)30(23(18)24(28)29)22(16-28)26(32)34-27-20-10-4-3-9-19(20)25(31)33-27/h3-6,8-11,16,24,27H,2,7,12-15H2,1H3/t24-,27?,28+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AF 698
CAS:AF 698 is a peripheral vasodilator. AF 698 may have a protective effect against the lethalality of hypobaric hypoxia.Formula:C28H26N2O4Color and Shape:SolidMolecular weight:454.52
