CAS 82975-92-6

2-[(4-carboxy-2-ethylbutoxy)carbonyl]benzoic acid

Description:

2-[(4-Carboxy-2-ethylbutoxy)carbonyl]benzoic acid, with the CAS number 82975-92-6, is an organic compound characterized by its complex structure that includes both carboxylic acid and ester functional groups. This compound features a benzoic acid moiety, which contributes to its acidity and potential for hydrogen bonding. The presence of the 4-carboxy-2-ethylbutoxy group enhances its solubility in polar solvents and may influence its biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular structure suggests that it may exhibit moderate to high polarity, affecting its interactions in various chemical environments. Additionally, the presence of multiple functional groups may allow for diverse reactivity, making it a candidate for further chemical modifications. Overall, this compound's unique characteristics stem from its functional groups and structural complexity, which can be leveraged in various chemical applications.

Formula: C₁₅H₁₈O₆

InChI: InChI=1/C15H18O6/c1-2-10(7-8-13(16)17)9-21-15(20)12-6-4-3-5-11(12)14(18)19/h3-6,10H,2,7-9H2,1H3,(H,16,17)(H,18,19)

SMILES: CCC(CCC(=O)O)COC(=O)c1ccccc1C(=O)O

Mono(4-​carboxy-​2-​ethylbutyl) Phthalate-d4

Controlled Product

CAS: 82975-92-6

Formula: C₁₅D₄H₁₄O₆

Color and Shape: Neat

Molecular weight: 298.325

Ref: TR-M525402

Mono(4-​carboxy-​2-​ethylbutyl) Phthalate

Controlled Product

CAS: 82975-92-6

Formula: C₁₅H₁₈O₆

Color and Shape: Neat

Molecular weight: 294.3

Ref: TR-M525400