CAS 82975-94-8

2-({[2-(2-hydroxyethyl)hexyl]oxy}carbonyl)benzoic acid

Description:

2-({[2-(2-hydroxyethyl)hexyl]oxy}carbonyl)benzoic acid, with CAS number 82975-94-8, is an organic compound characterized by its complex structure that includes a benzoic acid moiety and an ether linkage. This substance features a long hydrocarbon chain, which contributes to its hydrophobic properties, while the hydroxyethyl group introduces hydrophilicity, allowing for potential interactions with polar solvents. The presence of the carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit acidic behavior in solution. Its unique structure suggests potential applications in various fields, including pharmaceuticals, where it may serve as an intermediate or a functional additive. Additionally, the compound's solubility characteristics can be influenced by the balance between its hydrophobic and hydrophilic regions, making it of interest in formulations that require specific solubility profiles. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical applications.

Formula: C₁₆H₂₂O₅

InChI: InChI=1/C16H22O5/c1-2-3-6-12(9-10-17)11-21-16(20)14-8-5-4-7-13(14)15(18)19/h4-5,7-8,12,17H,2-3,6,9-11H2,1H3,(H,18,19)

SMILES: CCCCC(CCO)COC(=O)c1ccccc1C(=O)O

Synonyms:

• IFZJAYPKYNPJTC-UHFFFAOYSA-N
• 1,2-Benzenedicarboxylic acid, 1-[2-(2-hydroxyethyl)hexyl] ester
• Mono(2-(2-hydroxyethyl)hexyl) Phthalate

Mono(2-​(2-​hydroxyethyl)​hexyl) Phthalate-d4

Controlled Product

CAS: 82975-94-8

Formula: C₁₅D₄H₁₈O₃·CO₂

Color and Shape: Neat

Molecular weight: 298.368

Ref: TR-M546542

Mono(2-​(2-​hydroxyethyl)​hexyl) Phthalate

Controlled Product

CAS: 82975-94-8

Formula: C₁₅H₂₂O₃·CO₂

Color and Shape: Neat

Molecular weight: 294.343

Ref: TR-M546540