
CAS 82982-60-3
:1-[2-(Hydroxymethyl)-1H-imidazol-5-yl]ethanone
Description:
1-[2-(Hydroxymethyl)-1H-imidazol-5-yl]ethanone, with the CAS number 82982-60-3, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a hydroxymethyl group attached to the imidazole ring, contributing to its reactivity and potential applications in various chemical reactions. The ethanone moiety indicates the presence of a ketone functional group, which can participate in nucleophilic addition reactions. The compound is typically soluble in polar solvents due to the presence of hydroxyl and carbonyl groups, which can engage in hydrogen bonding. Its unique structure suggests potential uses in pharmaceuticals, biochemistry, and as a building block in organic synthesis. Additionally, the presence of the imidazole ring may impart biological activity, making it of interest in medicinal chemistry. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, with implications for research and development in various scientific fields.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c1-4(10)5-2-7-6(3-9)8-5/h2,9H,3H2,1H3,(H,7,8)
InChI key:InChIKey=MGSUZKWFACFSDH-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1NC(CO)=NC1
Synonyms:- Ethanone, 1-[2-(hydroxymethyl)-1H-imidazol-5-yl]-
- 4-Acetyl-2-(hydroxymethyl)imidazole
- 1-[2-(Hydroxymethyl)-1H-imidazol-5-yl]ethanone
- 1-[2-(Hydroxymethyl)-1H-imidazol-4-yl]ethan-1-one
- Ethanone, 1-[2-(hydroxymethyl)-1H-imidazol-4-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.