CAS 82988-08-7
:styryl 9M
Description:
Styryl 9M, identified by its CAS number 82988-08-7, is a chemical compound that belongs to the class of styryl derivatives, which are characterized by the presence of a styrene group. This compound typically exhibits properties associated with conjugated systems, such as enhanced stability and unique optical characteristics due to its extended π-electron system. Styryl compounds are often utilized in various applications, including organic electronics, dyes, and fluorescent materials, owing to their ability to absorb and emit light effectively. The specific characteristics of Styryl 9M may include its solubility in organic solvents, potential for photochemical reactivity, and utility in polymerization processes. Additionally, like many styryl compounds, it may exhibit interesting thermal and chemical stability, making it suitable for various industrial applications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C27H31ClN2O4S
InChI:InChI=1/C27H31N2S.ClHO4/c1-27(2)18-21(11-10-20-12-14-23(15-13-20)28(3)4)16-22(19-27)17-26-29(5)24-8-6-7-9-25(24)30-26;2-1(3,4)5/h6-17H,18-19H2,1-5H3;(H,2,3,4,5)/q+1;/p-1
Synonyms:- 2-[(Z)-(3-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-5,5-dimethylcyclohex-2-en-1-ylidene)methyl]-3-methyl-1,3-benzothiazol-3-ium perchlorate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.