CAS 82989-82-0

5-amino-1-[5-O-(hydroxy{[hydroxy(phosphonooxy)phosphoryl]oxy}phosphoryl)-beta-D-ribofuranosyl]-1H-imidazole-4-carboxamide

Description:

5-amino-1-[5-O-(hydroxy{[hydroxy(phosphonooxy)phosphoryl]oxy}phosphoryl)-beta-D-ribofuranosyl]-1H-imidazole-4-carboxamide, with CAS number 82989-82-0, is a complex chemical compound that features a ribofuranosyl sugar moiety linked to an imidazole ring. This substance is characterized by the presence of multiple functional groups, including amino, hydroxyl, and carboxamide groups, as well as phosphonate functionalities, which contribute to its biochemical reactivity and potential role in biological systems. The imidazole ring is known for its involvement in various biological processes, including enzyme catalysis and as a building block in nucleotides. The presence of phosphoryl groups suggests that this compound may play a role in energy transfer or signaling pathways within cells. Its structural complexity indicates potential applications in biochemistry and medicinal chemistry, particularly in the development of pharmaceuticals or as a biochemical probe. Overall, the compound's unique characteristics stem from its intricate structure and the interplay of its functional groups, making it a subject of interest in chemical and biological research.

Formula: C₉H₁₇N₄O₁₄P₃

InChI: InChI=1/C9H17N4O14P3/c10-7-4(8(11)16)12-2-13(7)9-6(15)5(14)3(25-9)1-24-29(20,21)27-30(22,23)26-28(17,18)19/h2-3,5-6,9,14-15H,1,10H2,(H2,11,16)(H,20,21)(H,22,23)(H2,17,18,19)/t3-,5-,6-,9-/m1/s1

SMILES: C([C@@H]1[C@H]([C@H]([C@H](n2cnc(c2N)C(=N)O)O1)O)O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O

5-Aminoimidazole-4-carboxamide-1-b-D-ribofuranosyl 5'-triphosphate

CAS: 82989-82-0

5-Aminoimidazole-4-carboxamide-1-b-D-ribofuranosyl 5'-triphosphate (AICAR) is a bifunctional agent that has been shown to stimulate the activity of adenylosuccinate synthetase, an enzyme that catalyzes the conversion of adenosine monophosphate (AMP) to adenosine triphosphate (ATP). AICAR is also a substrate for adenylosuccinate synthetase. The use of AICAR as a pharmacological agent has been associated with increased levels of nucleotides in cells and tissues. This may be due to the activation of AMPK, which stimulates ATP production by breaking down ATP through oxidative phosphorylation.
AICAR can be detected using chromatographic techniques, such as high performance liquid chromatography or thin layer chromatography.

Formula: C₉H₁₇N₄O₁₄P₃

Purity: Min. 95%

Molecular weight: 498.17 g/mol

Ref: 3D-NA01454