CAS 82997-65-7

2,5-Diamino-3-bromobenzonitrile

Description:

2,5-Diamino-3-bromobenzonitrile is an organic compound characterized by the presence of both amino and nitrile functional groups attached to a bromobenzene ring. The compound features two amino groups (-NH2) located at the 2 and 5 positions of the benzene ring, while a bromine atom is substituted at the 3 position, and a nitrile group (-C≡N) is present at the 1 position. This structure contributes to its potential reactivity and applications in various chemical syntheses. The presence of the amino groups makes it a potential candidate for further functionalization, while the bromine atom can serve as a leaving group in nucleophilic substitution reactions. The nitrile group adds to the compound's polarity and can influence its solubility in different solvents. Overall, 2,5-Diamino-3-bromobenzonitrile is of interest in medicinal chemistry and materials science due to its unique structural features and potential biological activities. Safety data should be consulted for handling, as with all chemical substances.

Formula: C₇H₆BrN₃

InChI: InChI=1S/C7H6BrN3/c8-6-2-5(10)1-4(3-9)7(6)11/h1-2H,10-11H2

InChI key: InChIKey=IKSPSVLLVGFKQX-UHFFFAOYSA-N

SMILES: C(#N)C1=C(N)C(Br)=CC(N)=C1

Synonyms:

• 2,5-Diamino-3-bromobenzonitrile
• Benzonitrile, 2,5-diamino-3-bromo-