CAS 83-08-9
:2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione
Description:
2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione, with the CAS number 83-08-9, is a chemical compound that belongs to the class of indene diones. This substance features a fused ring system that includes both indene and quinoline moieties, contributing to its unique structural and electronic properties. It typically appears as a solid, and its molecular structure allows for potential applications in organic synthesis and medicinal chemistry. The compound exhibits characteristics such as moderate solubility in organic solvents and may display fluorescence, making it of interest in various research fields. Its reactivity can be attributed to the presence of the diketone functional groups, which can participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, derivatives of this compound may exhibit biological activity, which has led to investigations into its potential pharmacological applications. Overall, 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C18H11NO2
InChI:InChI=1S/C18H11NO2/c20-17-12-6-2-3-7-13(12)18(21)16(17)15-10-9-11-5-1-4-8-14(11)19-15/h1-10,16H
InChI key:InChIKey=IZMJMCDDWKSTTK-UHFFFAOYSA-N
SMILES:O=C1C(C(=O)C=2C1=CC=CC2)C3=NC4=C(C=C3)C=CC=C4
Synonyms:- 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione
- Quinoline Yellow 2SF
- Quinophthalone
- Erio Chinoline Yellow 4G
- 1H-Indene-1,3(2H)-dione, 2-(2-quinolinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
