CAS 83-39-6
:1H-Imidazole-4,5-dicarboxamide
Description:
1H-Imidazole-4,5-dicarboxamide, also known as imidazole-4,5-dicarboxylic acid amide, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features two carboxamide functional groups attached to the imidazole ring, contributing to its solubility in polar solvents and its potential as a ligand in coordination chemistry. It is typically a white to off-white crystalline solid and is known for its stability under various conditions. The compound exhibits properties such as moderate acidity due to the presence of carboxamide groups, which can participate in hydrogen bonding, enhancing its reactivity and interaction with other molecules. 1H-Imidazole-4,5-dicarboxamide has applications in pharmaceuticals, biochemistry, and materials science, often serving as a building block in the synthesis of more complex molecules or as a reagent in various chemical reactions. Its unique structural features make it a subject of interest in research related to drug development and catalysis.
Formula:C5H6N4O2
InChI:InChI=1S/C5H6N4O2/c6-4(10)2-3(5(7)11)9-1-8-2/h1H,(H2,6,10)(H2,7,11)(H,8,9)
InChI key:InChIKey=NNWAARLSYSBVPB-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(C(N)=O)N=CN1
Synonyms:- 1H-imidazole-4,5-dicarboxamide
- Glycamide
- Glycamide 12
- Glycarbylamide
- Imidazole-4,5-dicarboxamide
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Imidazole-4,5-Dicarboxamide
CAS:Imidazole-4,5-DicarboxamideFormula:C5H6N4O2Purity:97%Molecular weight:154.131H-Imidazole-4,5-dicarboxamide
CAS:Formula:C5H6N4O2Purity:97%Color and Shape:SolidMolecular weight:154.12671H-Imidazole-4,5-dicarboxamide
CAS:1H-Imidazole-4,5-dicarboxamide is a detergent composition that contains antimicrobial agents. It has been shown to inhibit the growth of resistant mutants in vitro and is active against a broad spectrum of bacteria. Hydrogen bonding interactions between 1H-imidazole-4,5-dicarboxamide and the amide group on the cell membrane surface are thought to be responsible for its activity. This compound also inhibits nuclear DNA synthesis by binding to the enzyme topoisomerase II, which is necessary for DNA replication. The molecular weight of 1H-imidazole-4,5-dicarboxamide makes it useful as an analytical reagent in gas chromatography.Formula:C5H6N4O2Purity:Min. 95%Color and Shape:PowderMolecular weight:154.13 g/mol1H-Imidazole-4,5-dicarboxamide
CAS:1H-Imidazole-4,5-dicarboxamideFormula:C5H6N4O2Purity:97%Molecular weight:154.13




