CAS 83-81-8
:N1,N1,N2,N2-Tetraethyl-1,2-benzenedicarboxamide
Description:
N1,N1,N2,N2-Tetraethyl-1,2-benzenedicarboxamide, commonly referred to as TEBD, is an organic compound characterized by its structure, which features a benzene ring substituted with two carboxamide groups and four ethyl groups. This compound is typically a white to off-white solid at room temperature and is known for its relatively low solubility in water, while being more soluble in organic solvents. TEBD is primarily used in the field of organic synthesis and as a reagent in various chemical reactions. Its unique structure allows it to participate in coordination chemistry, making it useful in the development of metal complexes. The presence of multiple ethyl groups enhances its hydrophobic characteristics, influencing its reactivity and interaction with other chemical species. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper laboratory practices should be followed when working with this substance to ensure safety and compliance with regulatory standards.
Formula:C16H24N2O2
InChI:InChI=1S/C16H24N2O2/c1-5-17(6-2)15(19)13-11-9-10-12-14(13)16(20)18(7-3)8-4/h9-12H,5-8H2,1-4H3
InChI key:InChIKey=OPTBBAGXQYOFTL-UHFFFAOYSA-N
SMILES:C(N(CC)CC)(=O)C1=C(C(N(CC)CC)=O)C=CC=C1
Synonyms:- Analetil
- 1,2-Benzenedicarboxamide, N,N,N′,N′-tetraethyl-
- N1,N1,N2,N2-Tetraethyl-1,2-benzenedicarboxamide
- 1,2-Benzenedicarboxamide, N1,N1,N2,N2-tetraethyl-
- Phthalamide, N,N,N′,N′-tetraethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
