![2-hydroxy-4,8,8-trimethyl-9,10-dihydro-4H,5H-pyrano[4,3-f]chromene-5,6(8H)-dione](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F339889-2-hydroxy-488-trimethyl-910-dihydro-4h-5h-pyrano-43-f-chromene-56-8h-dione.webp&w=3840&q=75)
CAS 83-85-2
:2-hydroxy-4,8,8-trimethyl-9,10-dihydro-4H,5H-pyrano[4,3-f]chromene-5,6(8H)-dione
Description:
The chemical substance known as 2-hydroxy-4,8,8-trimethyl-9,10-dihydro-4H,5H-pyrano[4,3-f]chromene-5,6(8H)-dione, with the CAS number 83-85-2, is a complex organic compound characterized by its unique bicyclic structure that incorporates both pyran and chromene moieties. This compound typically exhibits a range of functional groups, including hydroxyl and carbonyl groups, which contribute to its reactivity and potential biological activity. It is often recognized for its vibrant color and may possess antioxidant properties, making it of interest in various fields, including pharmaceuticals and natural product chemistry. The presence of multiple methyl groups enhances its hydrophobic character, influencing its solubility and interaction with biological systems. Additionally, the compound's structural features may allow for various synthetic modifications, expanding its utility in chemical synthesis and research applications. Overall, this substance exemplifies the intricate relationship between molecular structure and chemical properties, highlighting its significance in organic chemistry.
Formula:C15H16O5
InChI:InChI=1/C15H16O5/c1-7-11-9(6-10(16)19-7)8-4-5-15(2,3)20-14(8)13(18)12(11)17/h6-7,16H,4-5H2,1-3H3
SMILES:CC1C2=C(C=C(O)O1)C1=C(C(=O)C2=O)OC(C)(C)CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
