CymitQuimica logo

CAS 83-93-2

:

5,6-dihydrobenzo[c]acridine-7-carboxylic acid

Description:
5,6-Dihydrobenzo[c]acridine-7-carboxylic acid, with the CAS number 83-93-2, is a chemical compound that belongs to the class of acridine derivatives. It features a fused polycyclic structure, which contributes to its unique chemical properties. This compound typically exhibits a solid state at room temperature and is characterized by its aromatic nature, which can influence its reactivity and interactions with other molecules. The presence of a carboxylic acid functional group (-COOH) enhances its solubility in polar solvents and allows for potential hydrogen bonding, making it useful in various chemical reactions and applications. Additionally, the compound may exhibit biological activity, which has been of interest in medicinal chemistry. Its structural features may also contribute to its potential as a fluorescent probe or in the development of organic materials. Overall, 5,6-dihydrobenzo[c]acridine-7-carboxylic acid is a versatile compound with applications in research and industry, particularly in the fields of organic synthesis and pharmaceuticals.
Formula:C18H13NO2
InChI:InChI=1/C18H13NO2/c20-18(21)16-13-7-3-4-8-15(13)19-17-12-6-2-1-5-11(12)9-10-14(16)17/h1-8H,9-10H2,(H,20,21)
SMILES:c1ccc2c(c1)CCc1c(c3ccccc3nc21)C(=O)O
Synonyms:
  • Benz[C]Acridine-7-Carboxylic Acid, 5,6-Dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.