
CAS 830-04-6
:N-[4-(Ethenyloxy)phenyl]acetamide
Description:
N-[4-(Ethenyloxy)phenyl]acetamide, with the CAS number 830-04-6, is an organic compound characterized by its amide functional group and an ethenyloxy substituent on a phenyl ring. This compound typically appears as a solid or liquid at room temperature, depending on its purity and specific conditions. It is soluble in organic solvents, which is common for compounds containing aromatic structures. The presence of the ethenyloxy group suggests potential reactivity, particularly in polymerization or cross-linking reactions, making it of interest in materials science and organic synthesis. The amide group contributes to its ability to form hydrogen bonds, influencing its solubility and interaction with other molecules. Additionally, this compound may exhibit biological activity, which could be relevant in pharmaceutical applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, N-[4-(Ethenyloxy)phenyl]acetamide is a versatile compound with potential applications in various fields, including organic chemistry and materials science.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c1-3-13-10-6-4-9(5-7-10)11-8(2)12/h3-7H,1H2,2H3,(H,11,12)
InChI key:InChIKey=WZEKTJVBLJKYCY-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=CC=C(OC=C)C=C1
Synonyms:- Acetamide, N-[4-(ethenyloxy)phenyl]-
- Acetanilide, 4′-(vinyloxy)-
- N-[4-(Ethenyloxy)phenyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.