CAS 83010-83-7
:7-methoxy-8-nitroquinoline
Description:
7-Methoxy-8-nitroquinoline is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system. The presence of a methoxy group (-OCH3) at the 7-position and a nitro group (-NO2) at the 8-position contributes to its unique chemical properties. This compound is typically a yellow to orange solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The methoxy group can enhance lipophilicity, potentially improving the compound's ability to penetrate biological membranes, while the nitro group may play a role in its reactivity and interaction with biological targets. Additionally, 7-methoxy-8-nitroquinoline may exhibit fluorescence properties, making it useful in various analytical applications. As with many nitro-containing compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, this compound represents a significant interest in both synthetic and applied chemistry fields.
Formula:C10H8N2O3
InChI:InChI=1/C10H8N2O3/c1-15-8-5-4-7-3-2-6-11-9(7)10(8)12(13)14/h2-6H,1H3
SMILES:COc1ccc2cccnc2c1N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
