CAS 83012-10-6

4-[(1-hydroxy-2-pyridyl)methyl]-2,8-bis(trifluoromethyl)quinoline

Description:

4-[(1-hydroxy-2-pyridyl)methyl]-2,8-bis(trifluoromethyl)quinoline is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with trifluoromethyl groups and a pyridyl moiety. The presence of the hydroxyl group on the pyridine ring enhances its potential for hydrogen bonding and may influence its solubility and reactivity. The trifluoromethyl groups contribute to the compound's lipophilicity and can significantly affect its electronic properties, making it a candidate for various applications in medicinal chemistry and materials science. This compound may exhibit interesting biological activities due to its structural features, which can interact with biological targets. Additionally, the unique combination of functional groups suggests potential for use in the development of pharmaceuticals or agrochemicals. Its CAS number, 83012-10-6, allows for easy identification and retrieval of information regarding its properties, safety data, and regulatory status. Overall, this compound represents a fascinating example of how structural modifications can lead to diverse chemical behaviors and applications.

Formula: C₁₇H₁₁F₆N₂O

InChI: InChI=1/C17H11F6N2O/c18-16(19,20)13-6-3-5-12-10(8-11-4-1-2-7-25(11)26)9-14(17(21,22)23)24-15(12)13/h1-7,9,26H,8H2

SMILES: C1=C[CH]N(C(=C1)Cc1cc(C(F)(F)F)nc2c1cccc2C(F)(F)F)O

2,8-Bis(trifluoromethyl)-4-quinolyl(1-oxypyrid-2-yl) methane

CAS: 83012-10-6

2,8-Bis(trifluoromethyl)-4-quinolyl(1-oxypyrid-2-yl) methane

Purity: ≥95%

Molecular weight: 372.26g/mol

Ref: 54-PC404545