CAS 83012-13-9

4-Chloro-2,8-bis(trifluoromethyl)quinoline

Description:

4-Chloro-2,8-bis(trifluoromethyl)quinoline is a synthetic organic compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a chlorine atom at the 4-position and two trifluoromethyl groups at the 2 and 8 positions significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a solid at room temperature and exhibits low solubility in water, while being more soluble in organic solvents. The trifluoromethyl groups enhance its lipophilicity and can impart unique electronic properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be attributed to its structural features. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4-Chloro-2,8-bis(trifluoromethyl)quinoline is a notable compound in the field of organic chemistry due to its distinctive structure and potential applications.

Formula: C₁₁H₄ClF₆N

InChI: InChI=1S/C11H4ClF6N/c12-7-4-8(11(16,17)18)19-9-5(7)2-1-3-6(9)10(13,14)15/h1-4H

InChI key: InChIKey=ZSQOESPYYNJBCZ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C2=C(C(Cl)=CC(C(F)(F)F)=N2)C=CC1

Synonyms:

• 2,8-Bis(trifluoromethyl)-4-chloroquinoline
• Quinoline, 4-chloro-2,8-bis(trifluoromethyl)-
• 4-Chloro-2,8-bis(trifluoromethyl)quinoline

2,8-BIS(TRIFLUOROMETHYL)-4-CHLOROQUINOLINE

CAS: 83012-13-9

Formula: C₁₁H₄ClF₆N

Purity: 98%

Color and Shape: Solid

Molecular weight: 299.5996

Ref: IN-DA003G75

2,8-Bis(trifluoromethyl)-4-chloroquinoline

CAS: 83012-13-9

2,8-Bis(trifluoromethyl)-4-chloroquinoline

Formula: C₁₁H₄ClF₆N

Purity: 97%

Color and Shape: white crystalline powder

Molecular weight: 299.60g/mol

Ref: 54-PC9012

2,8-Bis(trifluoromethyl)-4-chloroquinoline

CAS: 83012-13-9

Formula: C₁₁H₄ClF₆N

Purity: 98%

Color and Shape: Solid

Molecular weight: 299.6

Ref: 10-F008202