
CAS 83012-15-1
:α-Hydroxy-2-pyridineacetonitrile
Description:
α-Hydroxy-2-pyridineacetonitrile, with the CAS number 83012-15-1, is an organic compound characterized by its pyridine ring and a hydroxyl group adjacent to a nitrile functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The nitrile group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the pyridine moiety imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, α-hydroxy compounds are often involved in biological processes, which may suggest potential applications in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C7H6N2O
InChI:InChI=1S/C7H6N2O/c8-5-7(10)6-3-1-2-4-9-6/h1-4,7,10H
InChI key:InChIKey=QUNRUINSQUUCSU-UHFFFAOYSA-N
SMILES:C(C#N)(O)C1=CC=CC=N1
Synonyms:- 2-Pyridineglycolonitrile
- α-Hydroxy-2-pyridineacetonitrile
- 2-Pyridineacetonitrile, α-hydroxy-
- 2-Hydroxy-2-(pyridin-2-yl)acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.