CAS 83023-58-9
:3-Bromo-5-(2S)-2-pyrrolidinylpyridine
Description:
3-Bromo-5-(2S)-2-pyrrolidinylpyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a pyrrolidine moiety. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The pyrrolidine group contributes to the compound's stereochemistry, specifically the (2S) configuration, which can influence its biological activity and interactions with other molecules. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, its solubility and stability can vary depending on the solvent and conditions, which are important factors in its application in research and industry. Overall, 3-Bromo-5-(2S)-2-pyrrolidinylpyridine represents a versatile building block in organic synthesis and drug development.
Formula:C9H11BrN2
InChI:InChI=1S/C9H11BrN2/c10-8-4-7(5-11-6-8)9-2-1-3-12-9/h4-6,9,12H,1-3H2/t9-/m0/s1
InChI key:InChIKey=APOQHGHGEPQGOO-VIFPVBQESA-N
SMILES:BrC1=CC(=CN=C1)[C@@H]2CCCN2
Synonyms:- Pyridine, 3-bromo-5-(2-pyrrolidinyl)-, (S)-
- Pyridine, 3-bromo-5-(2S)-2-pyrrolidinyl-
- (S)-3-Bromo-5-pyrrolidin-2-yl-pyridine
- 3-Bromo-5-(2S)-2-pyrrolidinylpyridine
- 5-Bromonornicotine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.