CAS 83048-35-5
:Quercetin 3-O-sambubioside
Description:
Quercetin 3-O-sambubioside is a flavonoid glycoside, a type of plant-derived compound known for its antioxidant properties. It is a derivative of quercetin, which is widely recognized for its potential health benefits, including anti-inflammatory and anti-cancer effects. The structure of quercetin 3-O-sambubioside consists of a quercetin aglycone linked to a sambubioside moiety, which enhances its solubility and bioavailability. This compound is typically found in various plants, particularly in fruits and flowers, and is often studied for its role in traditional medicine. Its antioxidant activity is attributed to its ability to scavenge free radicals, thereby protecting cells from oxidative stress. Additionally, quercetin 3-O-sambubioside may exhibit other biological activities, including anti-allergic and cardiovascular protective effects. As with many flavonoids, its efficacy and mechanisms of action are subjects of ongoing research, highlighting its potential applications in health and nutrition.
Formula:C26H28O16
InChI:InChI=1/C26H28O16/c27-6-15-18(34)20(36)24(42-25-21(37)17(33)13(32)7-38-25)26(40-15)41-23-19(35)16-12(31)4-9(28)5-14(16)39-22(23)8-1-2-10(29)11(30)3-8/h1-5,13,15,17-18,20-21,24-34,36-37H,6-7H2/t13-,15-,17+,18-,20+,21-,24-,25+,26+/m1/s1
InChI key:InChIKey=NKFZLEYLWAFYEH-CJNLAGEVSA-N
SMILES:O(C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC(O)=C(O)C=C3)[C@H]4[C@H](O[C@H]5[C@H](O)[C@@H](O)[C@H](O)CO5)[C@@H](O)[C@H](O)[C@@H](CO)O4
Synonyms:- 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-[(2-O-β-<span class="text-smallcaps">D</smallcap>-xylopyranosyl-β-<smallcap>D</span>-glucopyranosyl)oxy]-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-((2-O-beta-D-xylopyranosyl-beta-D-glucopyranosyl)oxy)-
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2-O-β-<span class="text-smallcaps">D</smallcap>-xylopyranosyl-β-<smallcap>D</span>-glucopyranosyl)oxy]-
- Quercetin 3-O-sambubioside
- Quercetin 3-O-β-<span class="text-smallcaps">D</smallcap>-xylopyranosyl-(1→2)-β-<smallcap>D</span>-glucopyranoside
- Quercetin 3-sambubioside
- Quercetin 3-O-β-D-xylopyranosyl-(1→2)-β-D-glucopyranoside
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-
- 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-[(2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-4H-1-benzopyran-4-one
- quercetin 3-O-[beta-D-xylosyl-(1->2)-beta-D-glucoside]
- Quercetin-3-O-β-D-ribosyl-(1→2)-β-D-glucoside
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Quercetin 3-O-sambubioside
CAS:Quercetin 3-O-sambubioside is a natural flavonoid that scavenges free radicals and reducs cellular oxidative stress, stimulates nociceptors in mice.Formula:C26H28O16Purity:98.00%Color and Shape:SolidMolecular weight:596.49Quercetin 3-o-sambubioside
CAS:Quercetin 3-o-sambubioside is a flavonoid glycoside, which is often derived from plant sources such as the Sambucus species (elderberry) and other flavonoid-rich plants. Its structure includes the quercetin aglycone linked to a sambubiose sugar moiety, influencing its solubility, stability, and bioavailability compared to its aglycone counterpart. The mode of action of quercetin 3-o-sambubioside involves its potential ability to modulate oxidative stress and inflammation through interactions with various cellular signaling pathways, including antioxidant enzyme activation and inhibition of pro-inflammatory mediators.Formula:C26H28O16Purity:Min. 95%Molecular weight:596.5 g/mol



