
CAS 83054-45-9
:3-Methyl-4-(1-naphthalenyloxy)benzenamine
Description:
3-Methyl-4-(1-naphthalenyloxy)benzenamine, with the CAS number 83054-45-9, is an organic compound characterized by its aromatic structure, which includes a naphthalene moiety and an amine functional group. This compound features a methyl group and a naphthalenyloxy substituent on a benzene ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic naphthalene component. The presence of the amine group suggests potential basicity and reactivity, particularly in forming hydrogen bonds or participating in nucleophilic reactions. Additionally, the compound may display interesting biological activities, making it of interest in pharmaceutical research. Its synthesis and handling require standard laboratory safety precautions, as with many organic compounds, due to potential toxicity or reactivity. Overall, 3-Methyl-4-(1-naphthalenyloxy)benzenamine is a compound of interest in both synthetic organic chemistry and medicinal chemistry contexts.
Formula:C17H15NO
InChI:InChI=1S/C17H15NO/c1-12-11-14(18)9-10-16(12)19-17-8-4-6-13-5-2-3-7-15(13)17/h2-11H,18H2,1H3
InChI key:InChIKey=YSNDKUCPFBMCJL-UHFFFAOYSA-N
SMILES:O(C=1C2=C(C=CC1)C=CC=C2)C3=C(C)C=C(N)C=C3
Synonyms:- Benzenamine, 3-methyl-4-(1-naphthalenyloxy)-
- 3-Methyl-4-(1-naphthalenyloxy)benzenamine
- 3-Methyl-4-(naphthalen-1-yloxy)aniline
- 3-Methyl-4-(1-naphthyloxy)aniline
- 3-Methyl-4-naphthalen-1-yloxyaniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.