CAS 83066-88-0
:Fluazifop-P
Description:
Fluazifop-P is a selective systemic herbicide primarily used for controlling annual and perennial grasses in various crops. It belongs to the aryloxyphenoxypropionate class of herbicides and functions by inhibiting the enzyme acetyl-CoA carboxylase, which is crucial for fatty acid synthesis in plants. This inhibition disrupts the growth of susceptible grass species while leaving broadleaf plants largely unaffected, making it valuable in agricultural practices. Fluazifop-P is typically applied post-emergence, allowing it to target actively growing grasses. The compound is characterized by its relatively low toxicity to mammals and its moderate environmental persistence, which necessitates careful management to minimize potential impacts on non-target species and ecosystems. Additionally, it is often formulated with various adjuvants to enhance its efficacy and absorption by plant tissues. As with all herbicides, adherence to safety guidelines and regulations is essential to ensure effective and responsible use in agricultural settings.
Formula:C15H12F3NO4
InChI:InChI=1S/C15H12F3NO4/c1-9(14(20)21)22-11-3-5-12(6-4-11)23-13-7-2-10(8-19-13)15(16,17)18/h2-9H,1H3,(H,20,21)/t9-/m1/s1
InChI key:InChIKey=YUVKUEAFAVKILW-SECBINFHSA-N
SMILES:O(C1=CC=C(C(F)(F)F)C=N1)C2=CC=C(O[C@@H](C(O)=O)C)C=C2
Synonyms:- (+)-Fluazifop
- (2R)-2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid
- (2R)-2-[4-[[5-(Trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid
- (R)-2-(4-((5-(Trifluoromethyl)-2-pyridinyl)oxy)phenoxy)propanoic acid
- (R)-Fluazifop
- <span class="text-smallcaps">D</span>-Fluazifop
- Oneside P
- Propanoic acid, 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-, (2R)-
- Propanoic acid, 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-, (R)-
- Fluazifop-P
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Fluazifop-P (free acid) 100 µg/mL in Acetonitrile
CAS:Formula:C15H12F3NO4Color and Shape:Single SolutionMolecular weight:327.26Fluazifop-P (free acid)
CAS:Controlled ProductFormula:C15H12F3NO4Color and Shape:NeatMolecular weight:327.26
