
CAS 83088-28-2
:3′,4-Dihydroxy-3,5′-dimethoxybibenzyl
Description:
3′,4-Dihydroxy-3,5′-dimethoxybibenzyl, with the CAS number 83088-28-2, is an organic compound characterized by its unique bibenzyl structure, which consists of two benzene rings connected by a carbon chain. This compound features two hydroxyl (-OH) groups and two methoxy (-OCH₃) groups, contributing to its potential biological activity and solubility properties. The presence of hydroxyl groups often enhances the compound's ability to form hydrogen bonds, which can influence its reactivity and interaction with biological systems. Additionally, the methoxy groups can affect the compound's lipophilicity and overall stability. 3′,4-Dihydroxy-3,5′-dimethoxybibenzyl may exhibit antioxidant properties and has been studied for its potential therapeutic applications, particularly in the context of natural products derived from plants. Its structural characteristics suggest it could play a role in various biochemical pathways, making it of interest in both medicinal chemistry and pharmacology.
Formula:C16H18O4
InChI:InChI=1S/C16H18O4/c1-19-14-8-12(7-13(17)10-14)4-3-11-5-6-15(18)16(9-11)20-2/h5-10,17-18H,3-4H2,1-2H3
InChI key:InChIKey=BMSPEISBKGSBTR-UHFFFAOYSA-N
SMILES:C(CC1=CC(OC)=C(O)C=C1)C2=CC(OC)=CC(O)=C2
Synonyms:- 4′,5-Dihydroxy-3,3′-dimethoxybibenzyl
- 4-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol
- 3′,4-Dihydroxy-5,5′-dimethoxybibenzyl
- 3′,4-Dihydroxy-3,5′-dimethoxybibenzyl
- Phenol, 4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-methoxy-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ref: IN-DA004WTO
25mgTo inquire50mgTo inquire100mgTo inquire200mgTo inquire1mg208.00€5mg387.00€10mg653.00€Gigantol
CAS:Gigantol(Dendrophenol) (3,4'-dihydroxy-5,5'-dimethoxybibenzyl) is isolated from the stems of Dendrobium candidum.Formula:C16H18O4Purity:99.09% - 99.96%Color and Shape:SolidMolecular weight:274.31Ref: TM-TN7033
1mg90.00€1mL*10mM (DMSO)187.00€5mg192.00€10mg305.00€25mg510.00€50mg712.00€100mg982.00€500mg1,972.00€Gigantol
CAS:Gigantol analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C16H18O4Purity:(HPLC) ≥98%Color and Shape:ResinMolecular weight:274.324-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol
CAS:4-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol is a synthetic phenolic compound, which is derived through chemical synthesis involving aromatic substitution reactions. The compound's structure consists of two methoxy-substituted phenolic moieties connected by an ethyl bridge, which contributes to its potential bioactivity. The mode of action involves interaction with various biological pathways, potentially influencing oxidative stress by acting as an antioxidant or interacting with receptors to modulate signaling pathways. Its structural characteristics suggest utility in exploring phenolic interactions in biological systems.Formula:C16H18O4Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:274.31 g/molGigantol
CAS:4-(3-Hydroxy-5-methoxyphenethyl)-2-methoxyphenolFormula:C16H18O4Purity:98+%Molecular weight:274.31





