CAS 831-67-4
:Cycloundecanecarboxylic acid
Description:
Cycloundecanecarboxylic acid, with the CAS number 831-67-4, is a cyclic carboxylic acid characterized by its unique structure, which consists of a cycloundecane ring with a carboxylic acid functional group (-COOH) attached. This compound typically appears as a colorless to pale yellow solid at room temperature and is known for its relatively high melting point compared to many other carboxylic acids. Cycloundecanecarboxylic acid is soluble in organic solvents but has limited solubility in water due to its hydrophobic cycloalkane structure. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, this compound may exhibit interesting biological activities and can be utilized in the synthesis of more complex organic molecules. Its structural features and functional group make it a subject of interest in organic chemistry and materials science.
Formula:C12H22O2
InChI:InChI=1S/C12H22O2/c13-12(14)11-9-7-5-3-1-2-4-6-8-10-11/h11H,1-10H2,(H,13,14)
InChI key:InChIKey=BHECNPOVJVTHKS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCCCCCCCCC1
Synonyms:- Cycloundecanecarboxylic acid
- NSC 82299
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.