CymitQuimica logo

CAS 831191-83-4

:

2-amino-3-(2,4-difluorophenyl)propan-1-ol

Description:
2-amino-3-(2,4-difluorophenyl)propan-1-ol is an organic compound characterized by its amino alcohol structure, which features both an amino group (-NH2) and a hydroxyl group (-OH) attached to a propan-1-ol backbone. The presence of the 2,4-difluorophenyl group introduces significant polarity and potential for hydrogen bonding, influencing its solubility and reactivity. This compound is likely to exhibit basic properties due to the amino group, while the hydroxyl group contributes to its potential as a hydrogen bond donor and acceptor. The difluorophenyl substituent may enhance the compound's lipophilicity and alter its biological activity, making it of interest in medicinal chemistry. Additionally, the specific arrangement of the fluorine atoms can affect the compound's electronic properties and steric hindrance, which may influence its interactions with biological targets. Overall, 2-amino-3-(2,4-difluorophenyl)propan-1-ol is a versatile compound with potential applications in pharmaceuticals and chemical research.
Formula:C9H11F2NO
InChI:InChI=1/C9H11F2NO/c10-7-2-1-6(9(11)4-7)3-8(12)5-13/h1-2,4,8,13H,3,5,12H2
SMILES:c1cc(cc(c1CC(CO)N)F)F
Synonyms:
  • Benzenepropanol, Β-Amino-2,4-Difluoro-
  • β-Amino-2,4-difluorobenzenepropanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.