CAS 831191-86-7

2,4-Dimethyl-L-phenylalanine methyl ester

Description:

2,4-Dimethyl-L-phenylalanine methyl ester is an amino acid derivative characterized by its structural features, which include a phenylalanine backbone with two methyl groups attached to the 2 and 4 positions of the aromatic ring. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the presence of the phenyl group. The methyl ester functional group enhances its lipophilicity, making it useful in various chemical applications, including peptide synthesis and as a building block in medicinal chemistry. The compound may exhibit interesting biological properties, potentially influencing its interactions in biological systems. Its CAS number, 831191-86-7, allows for precise identification in chemical databases. As with many amino acid derivatives, it may participate in various chemical reactions, including esterification and amidation, and can serve as a chiral building block in asymmetric synthesis. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards.

Formula: C₁₂H₁₇NO₂

InChI: InChI=1S/C12H17NO2/c1-8-4-5-10(9(2)6-8)7-11(13)12(14)15-3/h4-6,11H,7,13H2,1-3H3/t11-/m0/s1

InChI key: InChIKey=KOTSKKYJFZLKQL-NSHDSACASA-N

SMILES: C([C@@H](C(OC)=O)N)C1=C(C)C=C(C)C=C1

Synonyms:

• 2,4-Dimethyl-L-phenylalanine methyl ester
• (2s)-2-Amino-3-(2,4-dimethylphenyl)propionic acid methyl ester
• (S)-Methyl 2-amino-3-(2,4-dimethylphenyl)propanoate
• L-Phenylalanine, 2,4-dimethyl-, methyl ester