CAS 831198-97-1

3-ethoxy-4-(prop-2-en-1-yloxy)benzoic acid

Description:

3-Ethoxy-4-(prop-2-en-1-yloxy)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an ethoxy group and an allyloxy group. The presence of the ethoxy group contributes to its solubility in organic solvents, while the carboxylic acid functional group imparts acidic properties, allowing for potential interactions in various chemical environments. The allyloxy substituent introduces a double bond, which can participate in further chemical reactions, such as polymerization or cross-linking. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests potential applications in materials science, particularly in the development of polymers or as intermediates in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its handling and application. Overall, 3-ethoxy-4-(prop-2-en-1-yloxy)benzoic acid is a versatile compound with a range of potential uses in various fields of chemistry.

Formula: C₁₂H₁₄O₄

InChI: InChI=1/C12H14O4/c1-3-7-16-10-6-5-9(12(13)14)8-11(10)15-4-2/h3,5-6,8H,1,4,7H2,2H3,(H,13,14)

SMILES: C=CCOc1ccc(cc1OCC)C(=O)O