CAS 831203-13-5
:5-Bromo-2-chloro-3-fluoropyridine
Description:
5-Bromo-2-chloro-3-fluoropyridine is a heterocyclic organic compound characterized by its pyridine ring, which contains three different halogen substituents: bromine, chlorine, and fluorine. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It exhibits a molecular formula that reflects the presence of these halogens, contributing to its reactivity and potential applications in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The presence of multiple halogens can influence its electronic properties, making it a useful intermediate in organic synthesis. Additionally, 5-Bromo-2-chloro-3-fluoropyridine may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its unique structure allows for participation in nucleophilic substitution reactions, and it may also serve as a building block for more complex molecules in medicinal chemistry. Safety precautions should be observed when handling this compound due to the potential hazards associated with halogenated organic substances.
Formula:C5H2BrClFN
InChI:InChI=1/C5H2BrClFN/c6-3-1-4(8)5(7)9-2-3/h1-2H
SMILES:c1c(cnc(c1F)Cl)Br
Synonyms:- 1,8-Octanediol, 3,3,4,4,5,5,6,6-octafluoro-
- 3,3,4,4,5,5,6,6-Octafluoro-1,8-octanediol
- 3,3,4,4,5,5,6,6-Octafluorooctane-1,8-diol
- 2-Chloro-3-Fluoro-5-Bromopyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-2-chloro-3-fluoropyridine
CAS:Formula:C5H2BrClFNPurity:>98.0%(GC)Color and Shape:White to Almost white powder to lumpMolecular weight:210.435-Bromo-2-chloro-3-fluoropyridine
CAS:Formula:C5H2BrClFNPurity:98%Color and Shape:SolidMolecular weight:210.43155-Bromo-2-chloro-3-fluoropyridine
CAS:5-Bromo-2-chloro-3-fluoropyridineFormula:C5H2BrClFNPurity:98%Color and Shape: white to off white fused solidMolecular weight:210.43g/mol5-Bromo-2-chloro-3-fluoropyridine
CAS:Formula:C5H2BrClFNPurity:98%Color and Shape:SolidMolecular weight:210.435-Bromo-2-chloro-3-fluoropyridine
CAS:5-Bromo-2-chloro-3-fluoropyridine is a catalytic reagent for the amination of anilines. It is extracted from coal tar, and is used in the manufacture of pesticides and pharmaceuticals. 5-Bromo-2-chloro-3-fluoropyridine has been shown to be an effective catalyst for the synthesis of functionalized adducts. This compound can also be used as a chemoselective agent in palladium catalysis, where it selectively adds hydrogen bromide to form aryl halides.Formula:C5H2BrCIFNPurity:Min. 95%Molecular weight:210.43 g/mol




