CAS 83140-94-7

3-(1H-Pyrrol-1-yl)benzenemethanol

Description:

3-(1H-Pyrrol-1-yl)benzenemethanol, with the CAS number 83140-94-7, is an organic compound characterized by the presence of a pyrrole ring attached to a benzyl alcohol structure. This compound features a pyrrole moiety, which is a five-membered aromatic ring containing one nitrogen atom, contributing to its potential biological activity. The benzyl alcohol part of the molecule provides a hydroxyl group (-OH), which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The compound may exhibit various chemical properties, including moderate polarity and potential reactivity due to the functional groups present. It is of interest in medicinal chemistry and organic synthesis, potentially serving as a building block for more complex molecules. Additionally, the presence of both aromatic and aliphatic components may influence its interactions in biological systems, making it a candidate for further research in pharmacology and material science. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₁H₁₁NO

InChI: InChI=1S/C11H11NO/c13-9-10-4-3-5-11(8-10)12-6-1-2-7-12/h1-8,13H,9H2

InChI key: InChIKey=QQXDXYAGEXWXQU-UHFFFAOYSA-N

SMILES: C(O)C=1C=C(C=CC1)N2C=CC=C2

Synonyms:

• Benzenemethanol, 3-(1H-pyrrol-1-yl)-
• (3-(1H-Pyrrol-1-yl)phenyl)methanol
• (3-Pyrrol-1-ylphenyl)methanol
• 3-(1H-Pyrrol-1-yl)benzenemethanol

[3-(1H-Pyrrol-1-yl)phenyl]methanol

CAS: 83140-94-7

[3-(1H-Pyrrol-1-yl)phenyl]methanol

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 173.21g/mol

Ref: 54-OR23351