CAS 83141-11-1

3-Amino-2,6-difluorobenzoic acid

Description:

3-Amino-2,6-difluorobenzoic acid is an aromatic compound characterized by the presence of an amino group and two fluorine atoms on a benzoic acid framework. The amino group (-NH2) is located at the meta position relative to the carboxylic acid group (-COOH), while the fluorine substituents are positioned at the 2 and 6 positions on the benzene ring. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. Its fluorine atoms contribute to its unique electronic properties, potentially enhancing its reactivity and influencing its interactions in biological systems. 3-Amino-2,6-difluorobenzoic acid may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential as a building block in the synthesis of more complex molecules. Additionally, its structural characteristics may impart specific biological activities, making it of interest in medicinal chemistry research.

Formula: C₇H₅F₂NO₂

InChI: InChI=1S/C7H5F2NO2/c8-3-1-2-4(10)6(9)5(3)7(11)12/h1-2H,10H2,(H,11,12)

InChI key: InChIKey=ORSUTLAFOCNIDY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(F)C(N)=CC=C1F

Synonyms:

• Benzoic acid, 3-amino-2,6-difluoro-
• 3-Amino-2,6-difluorobenzoic acid

3-Amino-2,6-difluorobenzoic acid

CAS: 83141-11-1

Formula: C₇H₅F₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.1169

Ref: IN-DA0059O1

3-Amino-2,6-difluorobenzoic acid

CAS: 83141-11-1

3-Amino-2,6-difluorobenzoic acid

Purity: 95

Molecular weight: 173.12g/mol

Ref: 54-PC99354

3-Amino-2,6-difluorobenzoic acid

CAS: 83141-11-1

Formula: C₇H₅F₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 173.119

Ref: 10-F037149