
CAS 83144-68-7
:5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-[(2-O-β-D-xylopyranosyl-β-D-galactopyranosyl)oxy]-4H-1-benzopyran-4-one
Description:
5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-[(2-O-β-D-xylopyranosyl-β-D-galactopyranosyl)oxy]-4H-1-benzopyran-4-one, with CAS number 83144-68-7, is a flavonoid compound characterized by its complex glycosylated structure. This substance features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of the benzopyran moiety indicates that it belongs to the flavonoid class, known for their diverse biological activities, including anti-inflammatory and anticancer effects. The glycosylation with xylopyranosyl and galactopyranosyl units enhances its solubility and bioavailability, making it of interest in pharmacological research. Its structural characteristics suggest potential interactions with various biological targets, which may lead to therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the hydroxyl groups, which may participate in hydrogen bonding and redox reactions. Overall, this compound exemplifies the intricate relationship between structure and function in flavonoids, highlighting its potential utility in health-related applications.
Formula:C26H28O15
InChI:InChI=1S/C26H28O15/c27-7-15-18(33)20(35)24(41-25-21(36)17(32)13(31)8-37-25)26(39-15)40-23-19(34)16-12(30)5-11(29)6-14(16)38-22(23)9-1-3-10(28)4-2-9/h1-6,13,15,17-18,20-21,24-33,35-36H,7-8H2/t13-,15-,17+,18+,20+,21-,24-,25+,26+/m1/s1
InChI key:InChIKey=RXAXTTGJEMODPY-IHPAPMAYSA-N
SMILES:O(C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC=C(O)C=C3)[C@H]4[C@H](O[C@H]5[C@H](O)[C@@H](O)[C@H](O)CO5)[C@@H](O)[C@@H](O)[C@@H](CO)O4
Synonyms:- Kaempferol-3-O-β-D-xylopyranosyl-(1→2)-O-β-D-galactopyranoside
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2-O-β-D-xylopyranosyl-β-D-galactopyranosyl)oxy]-
- 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-[(2-O-β-D-xylopyranosyl-β-D-galactopyranosyl)oxy]-4H-1-benzopyran-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Rustoside
CAS:<p>Rustoside is a natural product that can be used as a reference standard. The CAS number of Rustoside is 83144-68-7.</p>Formula:C26H28O15Color and Shape:SolidMolecular weight:580.495
