CAS 83150-78-1
:(1R)-α,α,4-Trimethyl-3-cyclohexene-1-methanethiol
Description:
(1R)-α,α,4-Trimethyl-3-cyclohexene-1-methanethiol is an organic compound characterized by its unique structure, which includes a cyclohexene ring with multiple methyl groups and a thiol functional group. This compound is a member of the thiol family, which are known for their distinctive sulfur-containing functional group (-SH), contributing to their characteristic odors and reactivity. The presence of the trimethyl groups enhances the steric hindrance around the double bond, influencing its reactivity and stability. This compound is likely to exhibit hydrophobic properties due to its hydrocarbon structure, making it less soluble in water but more soluble in organic solvents. Additionally, the thiol group can participate in various chemical reactions, including oxidation and formation of disulfides, which are important in biochemical processes. Its specific stereochemistry, indicated by the (1R) designation, suggests that it may exhibit chiral properties, potentially leading to different biological activities or interactions depending on its orientation. Overall, this compound's unique structure and functional groups contribute to its potential applications in organic synthesis and fragrance chemistry.
Formula:C10H18S
InChI:InChI=1S/C10H18S/c1-8-4-6-9(7-5-8)10(2,3)11/h4,9,11H,5-7H2,1-3H3/t9-/m0/s1
InChI key:InChIKey=ZQPCOAKGRYBBMR-VIFPVBQESA-N
SMILES:C(C)(C)(S)[C@@H]1CCC(C)=CC1
Synonyms:- (+)-(R)-1-p-Menthene-8-thiol
- (1R)-α,α,4-Trimethyl-3-cyclohexene-1-methanethiol
- 2-[(1R)-4-methyl-1-cyclohex-3-enyl]propane-2-thiol
- 280-198-5
- 3-Cyclohexene-1-methanethiol, α,α,4-trimethyl-, (1R)-
- 3-Cyclohexene-1-methanethiol, α,α,4-trimethyl-, (R)-
- (R)-α,α,4-Trimethylcyclohex-3-ene-1-methanethiol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
