CAS 83160-78-5
:5-(aminomethyl)-1,2-dihydro-3H-1,2,4-triazol-3-one
Description:
5-(Aminomethyl)-1,2-dihydro-3H-1,2,4-triazol-3-one, with the CAS number 83160-78-5, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocycle containing three nitrogen atoms. This compound features an amino group (-NH2) attached to a methylene bridge (-CH2-) linked to the triazole, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which enhances its utility in various chemical applications. The presence of the amino group suggests potential for hydrogen bonding, making it interesting for pharmaceutical research, particularly in the development of antimicrobial or antifungal agents. Additionally, the compound may exhibit properties such as moderate stability under standard conditions, but its reactivity can vary depending on the surrounding environment and functional groups present. Overall, this compound's unique structure and functional groups make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C3H6N4O
InChI:InChI=1/C3H6N4O/c4-1-2-5-3(8)7-6-2/h1,4H2,(H2,5,6,7,8)
SMILES:C(c1nc(n[nH]1)O)N
Synonyms:- 3H-1,2,4-Triazol-3-one, 5-(aminomethyl)-1,2-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
