CAS 83164-90-3

2-chloro-N-(2,4-difluorophenyl)pyridine-3-carboxamide

Description:

2-Chloro-N-(2,4-difluorophenyl)pyridine-3-carboxamide, with the CAS number 83164-90-3, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a carboxamide group and a chloro group, as well as a difluorophenyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in pharmaceutical research. The presence of halogen atoms, specifically chlorine and fluorine, often influences its reactivity and interaction with biological targets. Additionally, the pyridine ring contributes to its aromatic character, which can affect its electronic properties and stability. The compound may be utilized in various applications, including medicinal chemistry, where it could serve as a lead compound for the development of new therapeutic agents. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₂H₇ClF₂N₂O

InChI: InChI=1/C12H7ClF2N2O/c13-11-8(2-1-5-16-11)12(18)17-10-4-3-7(14)6-9(10)15/h1-6H,(H,17,18)

InChI key: InChIKey=VXHSATAEEHCPFE-UHFFFAOYSA-N

SMILES: C(NC1=C(F)C=C(F)C=C1)(=O)C2=C(Cl)N=CC=C2

Synonyms:

• 2-Chloro-N-(2,4-difluorophenyl)-3-pyridinecarboxamide
• 2-Chloro-N-(2,4-difluorophenyl)nicotinamide
• 3-pyridinecarboxamide, 2-chloro-N-(2,4-difluorophenyl)-

2-Chloro-N-(2,4-difluorophenyl)nicotinamide

CAS: 83164-90-3

2-Chloro-N-(2,4-difluorophenyl)nicotinamide

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 268.65g/mol

Ref: 54-PC31803