CAS 83168-64-3

3-Amino-1,2,4-butanetriol

Description:

3-Amino-1,2,4-butanetriol, with the CAS number 83168-64-3, is an organic compound characterized by the presence of an amino group and multiple hydroxyl groups. This triol features a four-carbon backbone, making it a member of the aliphatic alcohols. The amino group imparts basic properties, while the hydroxyl groups contribute to its hydrophilicity and ability to form hydrogen bonds, enhancing its solubility in water. The compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is often used in biochemical applications, including as a potential building block in the synthesis of pharmaceuticals or as a reagent in organic chemistry. The presence of multiple functional groups allows for diverse reactivity, making it a versatile compound in synthetic pathways. Additionally, its safety profile should be considered, as with any chemical substance, necessitating proper handling and storage protocols to mitigate any potential hazards.

Formula: C₄H₁₁NO₃

InChI: InChI=1S/C4H11NO3/c5-3(1-6)4(8)2-7/h3-4,6-8H,1-2,5H2

InChI key: InChIKey=PMLGQXIKBPFHJZ-UHFFFAOYSA-N

SMILES: C(C(CO)O)(CO)N

Synonyms:

• 2-Amino-1,3,4-butanetriol
• 1,2,4-Butanetriol, 3-amino-
• 3-Amino-1,2,4-butanetriol