CymitQuimica logo

CAS 83169-86-2

:

3-(Bromomethyl)-3′-(trifluoromethyl)-1,1′-biphenyl

Description:
3-(Bromomethyl)-3′-(trifluoromethyl)-1,1′-biphenyl, with CAS number 83169-86-2, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a bromomethyl group (-CH2Br) and a trifluoromethyl group (-CF3) attached to the biphenyl framework, contributing to its unique chemical properties. The presence of the bromomethyl group makes it a potential electrophile, while the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and stability. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the presence of halogen atoms in its structure may impart specific characteristics such as increased electronegativity and potential for participating in halogen bonding interactions.
Formula:C14H10BrF3
InChI:InChI=1S/C14H10BrF3/c15-9-10-3-1-4-11(7-10)12-5-2-6-13(8-12)14(16,17)18/h1-8H,9H2
InChI key:InChIKey=QIIJWJVRSUPHRB-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1)C2=CC(CBr)=CC=C2
Synonyms:
  • 3-(Bromomethyl)-3′-(trifluoromethyl)-1,1′-biphenyl
  • 1,1′-Biphenyl, 3-(bromomethyl)-3′-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.