CAS 83176-72-1

2-Propanol, 1-(dimethylamino)-, hydrochloride (1:1), homopolymer

Description:

2-Propanol, 1-(dimethylamino)-, hydrochloride (1:1), homopolymer, with CAS number 83176-72-1, is a polymeric compound derived from the polymerization of 2-propanol and dimethylamino groups. This substance typically exhibits characteristics such as being a white to off-white solid or powder, soluble in water due to the presence of the hydrochloride group, which enhances its ionic nature. The polymer structure contributes to its viscosity and potential applications in various fields, including pharmaceuticals and cosmetics, where it may serve as a stabilizer or thickening agent. The presence of dimethylamino groups can impart basic properties, allowing for interactions with other chemical species. Additionally, this compound may exhibit biocompatibility, making it suitable for use in biological applications. As with many polymers, its physical and chemical properties can vary based on molecular weight and degree of polymerization, influencing its behavior in different environments. Safety data should be consulted for handling and usage guidelines, as with any chemical substance.

Formula: (C₅H₁₃NO·ClH)x

InChI: InChI=1S/C5H13NO.ClH/c1-5(7)4-6(2)3;/h5,7H,4H2,1-3H3;1H

InChI key: InChIKey=JUSZROWIGBIXOS-UHFFFAOYSA-N

SMILES: C(C(C)O)N(C)C.Cl

Synonyms:

• 2-Propanol, 1-(dimethylamino)-, hydrochloride (1:1), homopolymer
• Poly(2-hydroxypropyldimethylammonium hydrochloride)
• Poly-N,N-dimethyl-2-hydroxypropylammonium chloride
• 2-Propanol, 1-(dimethylamino)-, hydrochloride, homopolymer

2-Propanol, 1-(dimethylamino)-, hydrochloride (1:1), homopolymer

CAS: 83176-72-1

Formula: C₅H₁₄ClNO

Molecular weight: 139.6238

Ref: IN-DA01X48J