
CAS 83177-55-3
:1-(2-Chlorophenyl)-3-azabicyclo[3.1.0]hexane
Description:
1-(2-Chlorophenyl)-3-azabicyclo[3.1.0]hexane, identified by its CAS number 83177-55-3, is a bicyclic compound featuring a nitrogen atom within its ring structure. This compound is characterized by the presence of a 2-chlorophenyl group, which contributes to its unique chemical properties and potential biological activity. The bicyclic framework consists of a six-membered ring that incorporates a nitrogen atom, making it a member of the azabicyclic class of compounds. The chlorine substituent on the phenyl ring can influence the compound's reactivity, solubility, and interaction with biological targets. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The structural features of 1-(2-Chlorophenyl)-3-azabicyclo[3.1.0]hexane may allow it to interact with various receptors or enzymes, making it of interest in drug development and research. As with many chemical substances, understanding its characteristics requires consideration of its molecular structure, reactivity, and potential applications in various fields.
Formula:C11H12ClN
InChI:InChI=1S/C11H12ClN/c12-10-4-2-1-3-9(10)11-5-8(11)6-13-7-11/h1-4,8,13H,5-7H2
InChI key:InChIKey=JADNXVNMVPSASU-UHFFFAOYSA-N
SMILES:ClC1=C(C23C(C2)CNC3)C=CC=C1
Synonyms:- 1-(2-Chlorophenyl)-3-azabicyclo[3.1.0]hexane
- 3-Azabicyclo[3.1.0]hexane, 1-(2-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.