CAS 83178-70-5

3-[(4R)-5-oxo-2-thioxoimidazolidin-4-yl]propanoate

Description:

3-[(4R)-5-oxo-2-thioxoimidazolidin-4-yl]propanoate, with the CAS number 83178-70-5, is a chemical compound characterized by its imidazolidinone structure, which features a thioxo group and a propanoate moiety. This compound typically exhibits properties associated with both its imidazolidinone core and the presence of the thioxo functional group, which can influence its reactivity and biological activity. The stereochemistry indicated by the (4R) designation suggests that it has a specific three-dimensional arrangement, which can be crucial for its interactions in biological systems. Such compounds may exhibit potential pharmacological properties, making them of interest in medicinal chemistry. Additionally, the presence of the propanoate group may enhance solubility and bioavailability. Overall, the characteristics of this compound, including its molecular structure, functional groups, and stereochemistry, contribute to its potential applications in various fields, including pharmaceuticals and biochemistry.

Formula: C₆H₇N₂O₃S

InChI: InChI=1/C6H8N2O3S/c9-4(10)2-1-3-5(11)8-6(12)7-3/h3H,1-2H2,(H,9,10)(H2,7,8,11,12)/p-1/t3-/m1/s1

SMILES: C(CC(=O)[O-])[C@@H]1C(=NC(=N1)S)O

3-(5-Oxo-2-thioxoimidazolidin-4-yl)propanoic acid

CAS: 83178-70-5

Formula: C₆H₈N₂O₃S

Purity: %

Molecular weight: 188.2043

Ref: IN-DA008JD9

3-(5-Oxo-2-thioxoimidazolidin-4-yl)propanoic acid

CAS: 83178-70-5

3-(5-Oxo-2-thioxoimidazolidin-4-yl)propanoic acid

Purity: 95%

Molecular weight: 188.21g/mol

Ref: 54-OR1064200