
CAS 83178-71-6
:5-Ethyl-2-thioxo-4-imidazolidinone
Description:
5-Ethyl-2-thioxo-4-imidazolidinone is a heterocyclic compound characterized by its imidazolidinone structure, which includes a five-membered ring containing nitrogen and sulfur atoms. This compound features a thioxo group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential applications in various chemical reactions. The ethyl substituent enhances its lipophilicity, which may influence its solubility and interaction with biological systems. Typically, compounds of this class may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of the imidazolidinone framework suggests potential applications in pharmaceuticals, particularly as intermediates in the synthesis of bioactive molecules. Additionally, the compound's stability, reactivity, and potential for forming derivatives can be influenced by the specific functional groups attached to the ring structure. Overall, 5-Ethyl-2-thioxo-4-imidazolidinone represents a versatile compound with potential utility in various chemical and biological contexts.
Formula:C5H8N2OS
InChI:InChI=1S/C5H8N2OS/c1-2-3-4(8)7-5(9)6-3/h3H,2H2,1H3,(H2,6,7,8,9)
InChI key:InChIKey=VPGPZORJVJYRGV-UHFFFAOYSA-N
SMILES:C(C)C1C(=O)NC(=S)N1
Synonyms:- Hydantoin, 5-ethyl-2-thio-
- 5-Ethyl-2-thioxo-4-imidazolidinone
- 4-Imidazolidinone, 5-ethyl-2-thioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.