CAS 83184-12-7

N-[4-(1H-imidazol-5-yl)phenyl]-N'-methylimidoformamide

Description:

N-[4-(1H-imidazol-5-yl)phenyl]-N'-methylimidoformamide, with the CAS number 83184-12-7, is a chemical compound characterized by its unique structure that includes an imidazole ring and an amide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, stability, and reactivity. The presence of the imidazole moiety suggests potential biological activity, as imidazole derivatives are often found in pharmaceuticals and can interact with biological targets. The compound may also display hydrogen bonding capabilities due to the amide group, which can affect its interactions in various chemical environments. Additionally, its molecular structure may confer specific electronic properties, making it suitable for applications in medicinal chemistry or as a ligand in coordination chemistry. Overall, the characteristics of this compound make it a subject of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₁₁H₁₂N₄

InChI: InChI=1/C11H12N4/c1-12-7-14-10-4-2-9(3-5-10)11-6-13-8-15-11/h2-8H,1H3,(H,12,14)(H,13,15)

Synonyms:

• DA 4360

DA 4360

CAS: 83184-12-7

DA 4360 is a competitive H2-receptor antagonist with KB values consistent with standard assays.

Formula: C₁₁H₁₂N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 200.24

Ref: TM-T23941