CAS 83191-83-7

Tetrahydro-4-hydroxy-4-(trifluoromethyl)-2H-pyran-2-one

Description:

Tetrahydro-4-hydroxy-4-(trifluoromethyl)-2H-pyran-2-one, with the CAS number 83191-83-7, is a chemical compound characterized by its unique structural features, including a pyran ring and a trifluoromethyl group. This compound typically exhibits a colorless to pale yellow appearance and is soluble in organic solvents. The presence of the hydroxyl group contributes to its potential reactivity, making it a candidate for various chemical transformations. The trifluoromethyl group enhances its lipophilicity and can influence its biological activity, potentially making it useful in medicinal chemistry. Additionally, the compound may exhibit interesting properties such as stability under certain conditions and the ability to participate in hydrogen bonding due to the hydroxyl group. Its applications may extend to fields such as pharmaceuticals, agrochemicals, and materials science, where its unique properties can be harnessed for specific purposes. As with any chemical substance, proper handling and safety measures should be observed due to potential hazards associated with its use.

Formula: C₆H₇F₃O₃

InChI: InChI=1S/C6H7F3O3/c7-6(8,9)5(11)1-2-12-4(10)3-5/h11H,1-3H2

InChI key: InChIKey=VYHQZPKSTHSAFN-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1(O)CC(=O)OCC1

Synonyms:

• Tetrahydro-4-hydroxy-4-(trifluoromethyl)-2H-pyran-2-one
• 2H-Pyran-2-one, tetrahydro-4-hydroxy-4-(trifluoromethyl)-